C23H21N3O5S2 — CID 59282938
3-[5-(10-methoxy-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl)furan-2-yl]propyl 4-methylbenzenesulfonate (PubChem CID 59282938) has the molecular formula C23H21N3O5S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is 3-[5-(10-methoxy-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl)furan-2-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[5-(10-methoxy-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl)furan-2-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59282938 |
| Molecular Formula | C23H21N3O5S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 3-[5-(10-methoxy-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl)furan-2-yl]propyl 4-methylbenzenesulfonate |
| SMILES | COc1ccc2c(n1)sc1nc(-c3ccc(CCCOS(=O)(=O)c4ccc(C)cc4)o3)cn12 |
| InChI | InChI=1S/C23H21N3O5S2/c1-15-5-8-17(9-6-15)33(27,28)30-13-3-4-16-7-11-20(31-16)18-14-26-19-10-12-21(29-2)25-22(19)32-23(26)24-18/h5-12,14H,3-4,13H2,1-2H3 |
| InChIKey | COJKBLBKAJRLTI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|