C16H14FN3O2S — CID 59283077
4-[5-(3-fluoropropyl)furan-2-yl]-10-methoxy-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene (PubChem CID 59283077) has the molecular formula C16H14FN3O2S and a molecular weight of 331.37 g/mol. Its IUPAC name is 4-[5-(3-fluoropropyl)furan-2-yl]-10-methoxy-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene.
| Compound Name | 4-[5-(3-fluoropropyl)furan-2-yl]-10-methoxy-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
|---|---|
| PubChem CID | 59283077 |
| Molecular Formula | C16H14FN3O2S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-[5-(3-fluoropropyl)furan-2-yl]-10-methoxy-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
| SMILES | COc1ccc2c(n1)sc1nc(-c3ccc(CCCF)o3)cn12 |
| InChI | InChI=1S/C16H14FN3O2S/c1-21-14-7-5-12-15(19-14)23-16-18-11(9-20(12)16)13-6-4-10(22-13)3-2-8-17/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | OEIVXDMURYSKNS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |