About N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate
N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate (PubChem CID 59283234) has the molecular formula C10H20NO8S2-
and a molecular weight of 346.40 g/mol. Its IUPAC name is N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate.
Molecular Properties
| Compound Name | N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| PubChem CID | 59283234 |
| Molecular Formula | C10H20NO8S2- |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| SMILES | CC(C)(C)O/C([O-])=N/C(COS(C)(=O)=O)COS(C)(=O)=O |
| InChI | InChI=1S/C10H21NO8S2/c1-10(2,3)19-9(12)11-8(6-17-20(4,13)14)7-18-21(5,15)16/h8H,6-7H2,1-5H3,(H,11,12)/p-1 |
| InChIKey | OQZLCYFJSRPMBB-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 131.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate?
The IUPAC name of N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate (CID 59283234) is N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate.
What is the SMILES notation for N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate?
The canonical SMILES for N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate is CC(C)(C)O/C([O-])=N/C(COS(C)(=O)=O)COS(C)(=O)=O.
What is the InChIKey of N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate?
The InChIKey is OQZLCYFJSRPMBB-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H21NO8S2/c1-10(2,3)19-9(12)11-8(6-17-20(4,13)14)7-18-21(5,15)16/h8H,6-7H2,1-5H3,(H,11,12)/p-1.
What are the key properties of N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate?
N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate has a molecular weight of 346.40 g/mol, XLogP of -1.16, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,3-bis(methylsulfonyloxy)propan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate is sourced from PubChem (CID 59283234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).