About 4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan
4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan (PubChem CID 59283383) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is 4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan.
Analyze 4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan?
The IUPAC name of 4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan (CID 59283383) is 4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan.
What is the SMILES notation for 4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan?
The canonical SMILES for 4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan is CC1CC(C)C2=C1CCO2.
What is the InChIKey of 4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan?
The InChIKey is ANVZKJBUGVQIHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c1-6-5-7(2)9-8(6)3-4-10-9/h6-7H,3-5H2,1-2H3.
What are the key properties of 4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan?
4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan has a molecular weight of 138.21 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan is sourced from PubChem (CID 59283383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).