C4F18N5O4P5 — CID 59283658
2,2,4,6,8,10-hexafluoro-4,6,8,10-tetrakis(trifluoromethoxy)-1,3,5,7,9-pentaza-2λ5,4λ5,6λ5,8λ5,10λ5-pentaphosphacyclodeca-1,3,5,7,9-pentaene (PubChem CID 59283658) has the molecular formula C4F18N5O4P5 and a molecular weight of 678.91 g/mol. Its IUPAC name is 2,2,4,6,8,10-hexafluoro-4,6,8,10-tetrakis(trifluoromethoxy)-1,3,5,7,9-pentaza-2λ5,4λ5,6λ5,8λ5,10λ5-pentaphosphacyclodeca-1,3,5,7,9-pentaene.
| Compound Name | 2,2,4,6,8,10-hexafluoro-4,6,8,10-tetrakis(trifluoromethoxy)-1,3,5,7,9-pentaza-2λ5,4λ5,6λ5,8λ5,10λ5-pentaphosphacyclodeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 59283658 |
| Molecular Formula | C4F18N5O4P5 |
| Molecular Weight | 678.91 g/mol |
| Exact Mass | 678.84 |
| IUPAC Name | 2,2,4,6,8,10-hexafluoro-4,6,8,10-tetrakis(trifluoromethoxy)-1,3,5,7,9-pentaza-2λ5,4λ5,6λ5,8λ5,10λ5-pentaphosphacyclodeca-1,3,5,7,9-pentaene |
| SMILES | FC(F)(F)OP1(F)=NP(F)(F)=NP(F)(OC(F)(F)F)=NP(F)(OC(F)(F)F)=NP(F)(OC(F)(F)F)=N1 |
| InChI | InChI=1S/C4F18N5O4P5/c5-1(6,7)28-33(19)23-32(17,18)24-34(20,29-2(8,9)10)26-36(22,31-4(14,15)16)27-35(21,25-33)30-3(11,12)13 |
| InChIKey | LELDRRNUQFGTDF-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.91 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|