C2H5F11N6OP6 — CID 59283659
2-ethoxy-2,4,4,6,6,8,8,10,10,12,12-undecafluoro-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene (PubChem CID 59283659) has the molecular formula C2H5F11N6OP6 and a molecular weight of 523.92 g/mol. Its IUPAC name is 2-ethoxy-2,4,4,6,6,8,8,10,10,12,12-undecafluoro-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene.
| Compound Name | 2-ethoxy-2,4,4,6,6,8,8,10,10,12,12-undecafluoro-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 59283659 |
| Molecular Formula | C2H5F11N6OP6 |
| Molecular Weight | 523.92 g/mol |
| Exact Mass | 523.88 |
| IUPAC Name | 2-ethoxy-2,4,4,6,6,8,8,10,10,12,12-undecafluoro-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene |
| SMILES | CCOP1(F)=NP(F)(F)=NP(F)(F)=NP(F)(F)=NP(F)(F)=NP(F)(F)=N1 |
| InChI | InChI=1S/C2H5F11N6OP6/c1-2-20-26(13)18-24(9,10)16-22(5,6)14-21(3,4)15-23(7,8)17-25(11,12)19-26/h2H2,1H3 |
| InChIKey | GSEBDNDLOVIKLS-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 83.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.92 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|