C6H14F6N4O2P4 — CID 59283678
2,2,4,4,6,8-hexafluoro-6,8-dipropoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene (PubChem CID 59283678) has the molecular formula C6H14F6N4O2P4 and a molecular weight of 412.09 g/mol. Its IUPAC name is 2,2,4,4,6,8-hexafluoro-6,8-dipropoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene.
| Compound Name | 2,2,4,4,6,8-hexafluoro-6,8-dipropoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 59283678 |
| Molecular Formula | C6H14F6N4O2P4 |
| Molecular Weight | 412.09 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 2,2,4,4,6,8-hexafluoro-6,8-dipropoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
| SMILES | CCCOP1(F)=NP(F)(F)=NP(F)(F)=NP(F)(OCCC)=N1 |
| InChI | InChI=1S/C6H14F6N4O2P4/c1-3-5-17-21(11)14-19(7,8)13-20(9,10)15-22(12,16-21)18-6-4-2/h3-6H2,1-2H3 |
| InChIKey | CZUSWZSNPYALRE-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.09 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|