C41H54NO16S+ — CID 59283853
4-[2,7-bis[2-(2-methoxyethoxy)ethoxy]-10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxy-3-[2-(2-methoxyethoxy)ethoxymethyl]-5-methylbenzoic acid (PubChem CID 59283853) has the molecular formula C41H54NO16S+ and a molecular weight of 848.94 g/mol. Its IUPAC name is 4-[2,7-bis[2-(2-methoxyethoxy)ethoxy]-10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxy-3-[2-(2-methoxyethoxy)ethoxymethyl]-5-methylbenzoic acid.
| Compound Name | 4-[2,7-bis[2-(2-methoxyethoxy)ethoxy]-10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxy-3-[2-(2-methoxyethoxy)ethoxymethyl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 59283853 |
| Molecular Formula | C41H54NO16S+ |
| Molecular Weight | 848.94 g/mol |
| Exact Mass | 848.32 |
| IUPAC Name | 4-[2,7-bis[2-(2-methoxyethoxy)ethoxy]-10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxy-3-[2-(2-methoxyethoxy)ethoxymethyl]-5-methylbenzoic acid |
| SMILES | COCCOCCOCc1cc(C(=O)O)cc(C)c1OC(=O)c1c2cc(OCCOCCOC)ccc2[n+](CCCS(=O)(=O)O)c2ccc(OCCOCCOC)cc12 |
| InChI | InChI=1S/C41H53NO16S/c1-29-24-30(40(43)44)25-31(28-55-18-17-52-14-11-49-2)39(29)58-41(45)38-34-26-32(56-21-19-53-15-12-50-3)6-8-36(34)42(10-5-23-59(46,47)48)37-9-7-33(27-35(37)38)57-22-20-54-16-13-51-4/h6-9,24-27H,5,10-23,28H2,1-4H3,(H-,43,44,46,47,48)/p+1 |
| InChIKey | SSRNGTKJTSEXOS-UHFFFAOYSA-O |
| XLogP | 4.05 |
| TPSA | 204.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.94 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|