About 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one
3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 59284131) has the molecular formula C11H9F3N2O
and a molecular weight of 242.20 g/mol. Its IUPAC name is 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 59284131 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1c(C(F)(F)F)nc2c(C)cccn2c1=O |
| InChI | InChI=1S/C11H9F3N2O/c1-6-4-3-5-16-9(6)15-8(11(12,13)14)7(2)10(16)17/h3-5H,1-2H3 |
| InChIKey | NCVFFGWVMONMQH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one (CID 59284131) is 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one is Cc1c(C(F)(F)F)nc2c(C)cccn2c1=O.
What is the InChIKey of 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is NCVFFGWVMONMQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N2O/c1-6-4-3-5-16-9(6)15-8(11(12,13)14)7(2)10(16)17/h3-5H,1-2H3.
What are the key properties of 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one?
3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 242.20 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,9-dimethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 59284131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).