C24H32O8 — CID 59284317
[(1R,2R,4R,6S,10S,11S)-2-acetyloxy-8,11-dihydroxy-5,5,9-trimethyl-14-methylidene-3,15-dioxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate (PubChem CID 59284317) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is [(1R,2R,4R,6S,10S,11S)-2-acetyloxy-8,11-dihydroxy-5,5,9-trimethyl-14-methylidene-3,15-dioxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate.
| Compound Name | [(1R,2R,4R,6S,10S,11S)-2-acetyloxy-8,11-dihydroxy-5,5,9-trimethyl-14-methylidene-3,15-dioxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
|---|---|
| PubChem CID | 59284317 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [(1R,2R,4R,6S,10S,11S)-2-acetyloxy-8,11-dihydroxy-5,5,9-trimethyl-14-methylidene-3,15-dioxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES | C=C1C(=O)[C@]23CC1C[C@H](O)[C@H]2C1(C)C(O)C[C@H](OC(C)=O)C(C)(C)[C@H]1C(=O)[C@@H]3OC(C)=O |
| InChI | InChI=1S/C24H32O8/c1-10-13-7-14(27)18-23(6)15(28)8-16(31-11(2)25)22(4,5)19(23)17(29)21(32-12(3)26)24(18,9-13)20(10)30/h13-16,18-19,21,27-28H,1,7-9H2,2-6H3/t13?,14-,15?,16-,18-,19+,21-,23?,24-/m0/s1 |
| InChIKey | VTMSSXBFBXBFIV-QMEQDLCXSA-N |
| XLogP | 1.36 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|