C10H8Cl2N4O2S — CID 59284574
4,6-dichloro-N-(2-methylsulfonylphenyl)-1,3,5-triazin-2-amine (PubChem CID 59284574) has the molecular formula C10H8Cl2N4O2S and a molecular weight of 319.17 g/mol. Its IUPAC name is 4,6-dichloro-N-(2-methylsulfonylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(2-methylsulfonylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 59284574 |
| Molecular Formula | C10H8Cl2N4O2S |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 4,6-dichloro-N-(2-methylsulfonylphenyl)-1,3,5-triazin-2-amine |
| SMILES | CS(=O)(=O)c1ccccc1Nc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C10H8Cl2N4O2S/c1-19(17,18)7-5-3-2-4-6(7)13-10-15-8(11)14-9(12)16-10/h2-5H,1H3,(H,13,14,15,16) |
| InChIKey | CCMPCJVZMBYWPU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |