C21H18ClF3N6O3S — CID 59284585
1-[7-chloro-6-[[4-(2-methylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone (PubChem CID 59284585) has the molecular formula C21H18ClF3N6O3S and a molecular weight of 526.93 g/mol. Its IUPAC name is 1-[7-chloro-6-[[4-(2-methylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[7-chloro-6-[[4-(2-methylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 59284585 |
| Molecular Formula | C21H18ClF3N6O3S |
| Molecular Weight | 526.93 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 1-[7-chloro-6-[[4-(2-methylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
| SMILES | CS(=O)(=O)c1ccccc1Nc1ncnc(Nc2cc3c(cc2Cl)CN(C(=O)C(F)(F)F)CC3)n1 |
| InChI | InChI=1S/C21H18ClF3N6O3S/c1-35(33,34)17-5-3-2-4-15(17)28-19-26-11-27-20(30-19)29-16-9-12-6-7-31(18(32)21(23,24)25)10-13(12)8-14(16)22/h2-5,8-9,11H,6-7,10H2,1H3,(H2,26,27,28,29,30) |
| InChIKey | QRUUSJPJBXGAGF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.93 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |