C27H34N6O6S2 — CID 59285138
(2E)-N-[5-[3-(dimethylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-morpholin-4-ylimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide (PubChem CID 59285138) has the molecular formula C27H34N6O6S2 and a molecular weight of 602.74 g/mol. Its IUPAC name is (2E)-N-[5-[3-(dimethylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-morpholin-4-ylimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide.
| Compound Name | (2E)-N-[5-[3-(dimethylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-morpholin-4-ylimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 59285138 |
| Molecular Formula | C27H34N6O6S2 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | (2E)-N-[5-[3-(dimethylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-morpholin-4-ylimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide |
| SMILES | CN(C)CCCOc1ccc2nc(NC(=O)/C(=N/N3CCOCC3)c3ccc(S(=O)(=O)[C@H]4CCOC4)cc3)sc2n1 |
| InChI | InChI=1S/C27H34N6O6S2/c1-32(2)11-3-14-39-23-9-8-22-26(29-23)40-27(28-22)30-25(34)24(31-33-12-16-37-17-13-33)19-4-6-20(7-5-19)41(35,36)21-10-15-38-18-21/h4-9,21H,3,10-18H2,1-2H3,(H,28,30,34)/b31-24+/t21-/m0/s1 |
| InChIKey | BLEXIRQXGLJCSJ-LFUOZCIBSA-N |
| XLogP | 2.26 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|