C23H31ClN4O — CID 59285305
N-[2-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)ethyl]-1-methylpiperidine-4-carboxamide (PubChem CID 59285305) has the molecular formula C23H31ClN4O and a molecular weight of 414.98 g/mol. Its IUPAC name is N-[2-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)ethyl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[2-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)ethyl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 59285305 |
| Molecular Formula | C23H31ClN4O |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-[2-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)ethyl]-1-methylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)NCCn2c3c(c4cc(Cl)ccc42)C2CCC(C3)N2C)CC1 |
| InChI | InChI=1S/C23H31ClN4O/c1-26-10-7-15(8-11-26)23(29)25-9-12-28-19-5-3-16(24)13-18(19)22-20-6-4-17(27(20)2)14-21(22)28/h3,5,13,15,17,20H,4,6-12,14H2,1-2H3,(H,25,29) |
| InChIKey | UGDPZZJRZVGVIS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|