C23H27ClN4O — CID 59285333
1-(6-chloro-16-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(2-methylpyrimidin-5-yl)propan-2-ol (PubChem CID 59285333) has the molecular formula C23H27ClN4O and a molecular weight of 410.95 g/mol. Its IUPAC name is 1-(6-chloro-16-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(2-methylpyrimidin-5-yl)propan-2-ol.
| Compound Name | 1-(6-chloro-16-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(2-methylpyrimidin-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 59285333 |
| Molecular Formula | C23H27ClN4O |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-(6-chloro-16-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(2-methylpyrimidin-5-yl)propan-2-ol |
| SMILES | Cc1ncc(C(C)(O)Cn2c3c(c4ccc(Cl)cc42)C2CCCC(C3)N2C)cn1 |
| InChI | InChI=1S/C23H27ClN4O/c1-14-25-11-15(12-26-14)23(2,29)13-28-20-9-16(24)7-8-18(20)22-19-6-4-5-17(27(19)3)10-21(22)28/h7-9,11-12,17,19,29H,4-6,10,13H2,1-3H3 |
| InChIKey | GDAJGDUABULFHN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|