C21H27N3O2 — CID 59285497
1-[(4S,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-(5-methylpyrazol-1-yl)ethanone (PubChem CID 59285497) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[(4S,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-(5-methylpyrazol-1-yl)ethanone.
| Compound Name | 1-[(4S,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-(5-methylpyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 59285497 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-[(4S,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-(5-methylpyrazol-1-yl)ethanone |
| SMILES | Cc1ccnn1CC(=O)N1CC[C@@](O)(c2ccccc2)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H27N3O2/c1-16-11-13-22-24(16)15-20(25)23-14-12-21(26,17-7-3-2-4-8-17)18-9-5-6-10-19(18)23/h2-4,7-8,11,13,18-19,26H,5-6,9-10,12,14-15H2,1H3/t18-,19+,21-/m1/s1 |
| InChIKey | QKTXPSVYRUCIDA-SVFBPWRDSA-N |
| XLogP | 2.87 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |