C26H29NO3 — CID 59285601
7-[(4S,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 59285601) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is 7-[(4S,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 7-[(4S,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 59285601 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 7-[(4S,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2ccc(C(=O)N3CC[C@@](O)(c4ccccc4)[C@@H]4CCCC[C@H]43)cc21 |
| InChI | InChI=1S/C26H29NO3/c28-24-12-6-7-18-13-14-19(17-21(18)24)25(29)27-16-15-26(30,20-8-2-1-3-9-20)22-10-4-5-11-23(22)27/h1-3,8-9,13-14,17,22-23,30H,4-7,10-12,15-16H2/t22-,23-,26-/m1/s1 |
| InChIKey | QTBMBYCQYCKYQZ-JQYIIUTOSA-N |
| XLogP | 4.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |