C24H27N3O2 — CID 59285779
[(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1-methylindazol-3-yl)methanone (PubChem CID 59285779) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1-methylindazol-3-yl)methanone.
| Compound Name | [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1-methylindazol-3-yl)methanone |
|---|---|
| PubChem CID | 59285779 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1-methylindazol-3-yl)methanone |
| SMILES | Cn1nc(C(=O)N2CC[C@](O)(c3ccccc3)[C@H]3CCCC[C@H]32)c2ccccc21 |
| InChI | InChI=1S/C24H27N3O2/c1-26-20-13-7-5-11-18(20)22(25-26)23(28)27-16-15-24(29,17-9-3-2-4-10-17)19-12-6-8-14-21(19)27/h2-5,7,9-11,13,19,21,29H,6,8,12,14-16H2,1H3/t19-,21+,24-/m0/s1 |
| InChIKey | PHCORCYDWQXYME-LEEZEASISA-N |
| XLogP | 3.87 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |