C21H29F3N2O2 — CID 59285803
[(4R,4aS,8aR)-4-hydroxy-4-pentyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 59285803) has the molecular formula C21H29F3N2O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is [(4R,4aS,8aR)-4-hydroxy-4-pentyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(4R,4aS,8aR)-4-hydroxy-4-pentyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 59285803 |
| Molecular Formula | C21H29F3N2O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | [(4R,4aS,8aR)-4-hydroxy-4-pentyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | CCCCC[C@@]1(O)CCN(C(=O)c2ccc(C(F)(F)F)nc2)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H29F3N2O2/c1-2-3-6-11-20(28)12-13-26(17-8-5-4-7-16(17)20)19(27)15-9-10-18(25-14-15)21(22,23)24/h9-10,14,16-17,28H,2-8,11-13H2,1H3/t16-,17+,20+/m0/s1 |
| InChIKey | YAXOSLSWDJKSOU-SQGPQFPESA-N |
| XLogP | 4.82 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|