About 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide
2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide (PubChem CID 59285957) has the molecular formula C12H10F2N4O2
and a molecular weight of 280.23 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide.
Molecular Properties
| Compound Name | 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide |
| PubChem CID | 59285957 |
| Molecular Formula | C12H10F2N4O2 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide |
| SMILES | NC(=O)Nc1[nH]c(-c2cc(F)cc(F)c2)cc1C(N)=O |
| InChI | InChI=1S/C12H10F2N4O2/c13-6-1-5(2-7(14)3-6)9-4-8(10(15)19)11(17-9)18-12(16)20/h1-4,17H,(H2,15,19)(H3,16,18,20) |
| InChIKey | XSMCJRFNPCATKK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide?
The IUPAC name of 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide (CID 59285957) is 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide.
What is the SMILES notation for 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide?
The canonical SMILES for 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide is NC(=O)Nc1[nH]c(-c2cc(F)cc(F)c2)cc1C(N)=O.
What is the InChIKey of 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide?
The InChIKey is XSMCJRFNPCATKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N4O2/c13-6-1-5(2-7(14)3-6)9-4-8(10(15)19)11(17-9)18-12(16)20/h1-4,17H,(H2,15,19)(H3,16,18,20).
What are the key properties of 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide?
2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide has a molecular weight of 280.23 g/mol, XLogP of 1.55, 3 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carbamoylamino)-5-(3,5-difluorophenyl)-1H-pyrrole-3-carboxamide is sourced from PubChem (CID 59285957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).