About 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate
1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate (PubChem CID 59286376) has the molecular formula C10H12N4O4-2
and a molecular weight of 252.23 g/mol. Its IUPAC name is 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate.
Molecular Properties
| Compound Name | 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate |
| PubChem CID | 59286376 |
| Molecular Formula | C10H12N4O4-2 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate |
| SMILES | CC([O-])([O-])NNC(=O)C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C10H12N4O4/c1-10(17,18)14-13-9(16)8(15)12-11-7-5-3-2-4-6-7/h2-6,11,14H,1H3,(H,12,15)(H,13,16)/q-2 |
| InChIKey | OPKNRYPVKKJSQO-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate?
The IUPAC name of 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate (CID 59286376) is 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate.
What is the SMILES notation for 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate?
The canonical SMILES for 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate is CC([O-])([O-])NNC(=O)C(=O)NNc1ccccc1.
What is the InChIKey of 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate?
The InChIKey is OPKNRYPVKKJSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O4/c1-10(17,18)14-13-9(16)8(15)12-11-7-5-3-2-4-6-7/h2-6,11,14H,1H3,(H,12,15)(H,13,16)/q-2.
What are the key properties of 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate?
1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate has a molecular weight of 252.23 g/mol, XLogP of -2.86, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-oxo-2-(2-phenylhydrazinyl)acetyl]hydrazinyl]ethane-1,1-diolate is sourced from PubChem (CID 59286376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).