About 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine
6-(1,2,4-triazol-1-yl)pyrimidin-4-amine (PubChem CID 59286584) has the molecular formula C6H6N6
and a molecular weight of 162.16 g/mol. Its IUPAC name is 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine |
| PubChem CID | 59286584 |
| Molecular Formula | C6H6N6 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine |
| SMILES | Nc1cc(-n2cncn2)ncn1 |
| InChI | InChI=1S/C6H6N6/c7-5-1-6(10-3-9-5)12-4-8-2-11-12/h1-4H,(H2,7,9,10) |
| InChIKey | SNRRNNMZKXYZQS-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine?
The IUPAC name of 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine (CID 59286584) is 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine.
What is the SMILES notation for 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine?
The canonical SMILES for 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine is Nc1cc(-n2cncn2)ncn1.
What is the InChIKey of 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine?
The InChIKey is SNRRNNMZKXYZQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N6/c7-5-1-6(10-3-9-5)12-4-8-2-11-12/h1-4H,(H2,7,9,10).
What are the key properties of 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine?
6-(1,2,4-triazol-1-yl)pyrimidin-4-amine has a molecular weight of 162.16 g/mol, XLogP of -0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,2,4-triazol-1-yl)pyrimidin-4-amine is sourced from PubChem (CID 59286584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).