About [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol
[5-(hydroxymethyl)-1,3-dithian-5-yl]methanol (PubChem CID 59286722) has the molecular formula C6H12O2S2
and a molecular weight of 180.29 g/mol. Its IUPAC name is [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol |
| PubChem CID | 59286722 |
| Molecular Formula | C6H12O2S2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol |
| SMILES | OCC1(CO)CSCSC1 |
| InChI | InChI=1S/C6H12O2S2/c7-1-6(2-8)3-9-5-10-4-6/h7-8H,1-5H2 |
| InChIKey | UEFOKKJILQPGLE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol?
The IUPAC name of [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol (CID 59286722) is [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol.
What is the SMILES notation for [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol?
The canonical SMILES for [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol is OCC1(CO)CSCSC1.
What is the InChIKey of [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol?
The InChIKey is UEFOKKJILQPGLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2S2/c7-1-6(2-8)3-9-5-10-4-6/h7-8H,1-5H2.
What are the key properties of [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol?
[5-(hydroxymethyl)-1,3-dithian-5-yl]methanol has a molecular weight of 180.29 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-1,3-dithian-5-yl]methanol is sourced from PubChem (CID 59286722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).