C16H27NO4 — CID 59287267
methyl (2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopropyl]oxycarbonylamino]butanoate (PubChem CID 59287267) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is methyl (2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopropyl]oxycarbonylamino]butanoate.
| Compound Name | methyl (2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopropyl]oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 59287267 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | methyl (2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopropyl]oxycarbonylamino]butanoate |
| SMILES | C=CCCC[C@@H]1C[C@H]1OC(=O)N[C@H](C(=O)OC)C(C)(C)C |
| InChI | InChI=1S/C16H27NO4/c1-6-7-8-9-11-10-12(11)21-15(19)17-13(14(18)20-5)16(2,3)4/h6,11-13H,1,7-10H2,2-5H3,(H,17,19)/t11-,12-,13-/m1/s1 |
| InChIKey | XICWIJTZJWEJFY-JHJVBQTASA-N |
| XLogP | 3.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|