About 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid
5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid (PubChem CID 59287268) has the molecular formula C8H5BrN2O2
and a molecular weight of 241.04 g/mol. Its IUPAC name is 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid |
| PubChem CID | 59287268 |
| Molecular Formula | C8H5BrN2O2 |
| Molecular Weight | 241.04 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cn2c(Br)cccc2n1 |
| InChI | InChI=1S/C8H5BrN2O2/c9-6-2-1-3-7-10-5(8(12)13)4-11(6)7/h1-4H,(H,12,13) |
| InChIKey | OTRXOKOMHXXKKN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.04 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid?
The IUPAC name of 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid (CID 59287268) is 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid.
What is the SMILES notation for 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid?
The canonical SMILES for 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid is O=C(O)c1cn2c(Br)cccc2n1.
What is the InChIKey of 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid?
The InChIKey is OTRXOKOMHXXKKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2O2/c9-6-2-1-3-7-10-5(8(12)13)4-11(6)7/h1-4H,(H,12,13).
What are the key properties of 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid?
5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid has a molecular weight of 241.04 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromoimidazo[1,2-a]pyridine-2-carboxylic acid is sourced from PubChem (CID 59287268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).