C32H43NO4 — CID 59287884
methyl (2S,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-11-isocyano-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,14b-decahydropicene-2-carboxylate (PubChem CID 59287884) has the molecular formula C32H43NO4 and a molecular weight of 505.70 g/mol. Its IUPAC name is methyl (2S,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-11-isocyano-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,14b-decahydropicene-2-carboxylate.
| Compound Name | methyl (2S,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-11-isocyano-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,14b-decahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 59287884 |
| Molecular Formula | C32H43NO4 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | methyl (2S,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-11-isocyano-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,14b-decahydropicene-2-carboxylate |
| SMILES | [C-]#[N+]C1=C[C@]2(C)[C@H]3C(=O)C=C4[C@H]5C[C@@](C)(C(=O)OC)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C32H43NO4/c1-27(2)23-10-11-32(7)24(30(23,5)18-21(33-8)25(27)35)22(34)16-19-20-17-29(4,26(36)37-9)13-12-28(20,3)14-15-31(19,32)6/h16,18,20,23-24H,10-15,17H2,1-7,9H3/t20-,23+,24-,28-,29+,30+,31-,32-/m1/s1 |
| InChIKey | YJUAVKBFJMXVGP-SBWMNFPCSA-N |
| XLogP | 6.73 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|