C29H18F6N2O2 — CID 59287906
5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-2-(4-methylnaphthalen-1-yl)-1,3-benzoxazole (PubChem CID 59287906) has the molecular formula C29H18F6N2O2 and a molecular weight of 540.46 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-2-(4-methylnaphthalen-1-yl)-1,3-benzoxazole.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-2-(4-methylnaphthalen-1-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 59287906 |
| Molecular Formula | C29H18F6N2O2 |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-2-(4-methylnaphthalen-1-yl)-1,3-benzoxazole |
| SMILES | Cc1nc2cc(C(c3ccc4oc(-c5ccc(C)c6ccccc56)nc4c3)(C(F)(F)F)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C29H18F6N2O2/c1-15-7-10-21(20-6-4-3-5-19(15)20)26-37-23-14-18(9-12-25(23)39-26)27(28(30,31)32,29(33,34)35)17-8-11-24-22(13-17)36-16(2)38-24/h3-14H,1-2H3 |
| InChIKey | NZCJWZPVFPSQRZ-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |