C26H30O — CID 59287925
1,2,3,4,5,6,8,9,10,11-decamethylnaphtho[2,1-b][1]benzofuran (PubChem CID 59287925) has the molecular formula C26H30O and a molecular weight of 358.53 g/mol. Its IUPAC name is 1,2,3,4,5,6,8,9,10,11-decamethylnaphtho[2,1-b][1]benzofuran.
| Compound Name | 1,2,3,4,5,6,8,9,10,11-decamethylnaphtho[2,1-b][1]benzofuran |
|---|---|
| PubChem CID | 59287925 |
| Molecular Formula | C26H30O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 1,2,3,4,5,6,8,9,10,11-decamethylnaphtho[2,1-b][1]benzofuran |
| SMILES | Cc1c(C)c(C)c2c(oc3c(C)c(C)c4c(C)c(C)c(C)c(C)c4c32)c1C |
| InChI | InChI=1S/C26H30O/c1-11-12(2)16(6)22-21(15(11)5)18(8)20(10)26-24(22)23-17(7)13(3)14(4)19(9)25(23)27-26/h1-10H3 |
| InChIKey | JQBVOGQZJKPGFG-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |