About 3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine
3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine (PubChem CID 59288348) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine.
Analyze 3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine?
The IUPAC name of 3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine (CID 59288348) is 3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine.
What is the SMILES notation for 3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine?
The canonical SMILES for 3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine is CC1COC2=C(CCCC2)O1.
What is the InChIKey of 3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine?
The InChIKey is DVDCYHMLALILBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-7-6-10-8-4-2-3-5-9(8)11-7/h7H,2-6H2,1H3.
What are the key properties of 3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine?
3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine has a molecular weight of 154.21 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,3,5,6,7,8-hexahydro-1,4-benzodioxine is sourced from PubChem (CID 59288348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).