C78H93NS8 — CID 59288572
9-ethyl-3,6-bis[4-octyl-5-[5-[5-(3-octylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]carbazole (PubChem CID 59288572) has the molecular formula C78H93NS8 and a molecular weight of 1301.14 g/mol. Its IUPAC name is 9-ethyl-3,6-bis[4-octyl-5-[5-[5-(3-octylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]carbazole.
| Compound Name | 9-ethyl-3,6-bis[4-octyl-5-[5-[5-(3-octylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 59288572 |
| Molecular Formula | C78H93NS8 |
| Molecular Weight | 1301.14 g/mol |
| Exact Mass | 1299.51 |
| IUPAC Name | 9-ethyl-3,6-bis[4-octyl-5-[5-[5-(3-octylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]carbazole |
| SMILES | CCCCCCCCc1ccsc1-c1ccc(-c2ccc(-c3sc(-c4ccc5c(c4)c4cc(-c6cc(CCCCCCCC)c(-c7ccc(-c8ccc(-c9sccc9CCCCCCCC)s8)s7)s6)ccc4n5CC)cc3CCCCCCCC)s2)s1 |
| InChI | InChI=1S/C78H93NS8/c1-6-11-15-19-23-27-31-55-47-49-80-75(55)69-43-39-65(82-69)67-41-45-71(84-67)77-59(33-29-25-21-17-13-8-3)53-73(86-77)57-35-37-63-61(51-57)62-52-58(36-38-64(62)79(63)10-5)74-54-60(34-30-26-22-18-14-9-4)78(87-74)72-46-42-68(85-72)66-40-44-70(83-66)76-56(48-50-81-76)32-28-24-20-16-12-7-2/h35-54H,6-34H2,1-5H3 |
| InChIKey | RWVAWMYRYLTAQH-UHFFFAOYSA-N |
| XLogP | 29.25 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1301.14 |
| LogP ≤ 5 | 29.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|