C29H26IrN3O2- — CID 59288772
(Z)-4-hydroxypent-3-en-2-one;iridium;2-(3-methylbenzene-6-id-1-yl)-6,7-di(pyrrol-1-yl)quinoline (PubChem CID 59288772) has the molecular formula C29H26IrN3O2- and a molecular weight of 640.76 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;2-(3-methylbenzene-6-id-1-yl)-6,7-di(pyrrol-1-yl)quinoline.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-(3-methylbenzene-6-id-1-yl)-6,7-di(pyrrol-1-yl)quinoline |
|---|---|
| PubChem CID | 59288772 |
| Molecular Formula | C29H26IrN3O2- |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 641.17 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-(3-methylbenzene-6-id-1-yl)-6,7-di(pyrrol-1-yl)quinoline |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc[c-]c(-c2ccc3cc(-n4cccc4)c(-n4cccc4)cc3n2)c1.[Ir] |
| InChI | InChI=1S/C24H18N3.C5H8O2.Ir/c1-18-7-6-8-19(15-18)21-10-9-20-16-23(26-11-2-3-12-26)24(17-22(20)25-21)27-13-4-5-14-27;1-4(6)3-5(2)7;/h2-7,9-17H,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | AZZNTNXONADMGT-LWFKIUJUSA-N |
| XLogP | 6.63 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|