C28H32F2IrNO2- — CID 59288811
2-(3,5-dimethylbenzene-6-id-1-yl)-5,7-difluoroquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium (PubChem CID 59288811) has the molecular formula C28H32F2IrNO2- and a molecular weight of 644.78 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)-5,7-difluoroquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium.
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5,7-difluoroquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 59288811 |
| Molecular Formula | C28H32F2IrNO2- |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 645.20 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5,7-difluoroquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1[c-]c(-c2ccc3c(F)cc(F)cc3n2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C17H12F2N.C11H20O2.Ir/c1-10-5-11(2)7-12(6-10)16-4-3-14-15(19)8-13(18)9-17(14)20-16;1-10(2,3)8(12)7-9(13)11(4,5)6;/h3-6,8-9H,1-2H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | WMIHTNRBMLXPSU-HXIBTQJOSA-N |
| XLogP | 7.68 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|