C25H29FN5O7P — CID 59289223
N-[9-[(3aR,4R,6R,6aR)-6-[(E)-2-diethoxyphosphoryl-2-fluoroethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide (PubChem CID 59289223) has the molecular formula C25H29FN5O7P and a molecular weight of 561.51 g/mol. Its IUPAC name is N-[9-[(3aR,4R,6R,6aR)-6-[(E)-2-diethoxyphosphoryl-2-fluoroethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(3aR,4R,6R,6aR)-6-[(E)-2-diethoxyphosphoryl-2-fluoroethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 59289223 |
| Molecular Formula | C25H29FN5O7P |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | N-[9-[(3aR,4R,6R,6aR)-6-[(E)-2-diethoxyphosphoryl-2-fluoroethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide |
| SMILES | CCOP(=O)(OCC)/C(F)=C/[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C25H29FN5O7P/c1-5-34-39(33,35-6-2)17(26)12-16-19-20(38-25(3,4)37-19)24(36-16)31-14-29-18-21(27-13-28-22(18)31)30-23(32)15-10-8-7-9-11-15/h7-14,16,19-20,24H,5-6H2,1-4H3,(H,27,28,30,32)/b17-12+/t16-,19-,20-,24-/m1/s1 |
| InChIKey | RGFASEDRGAWLOT-ATBRFMSISA-N |
| XLogP | 4.57 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|