C18H31NO3 — CID 59289389
1-[(3aR,6aR)-5-(2,2-dimethylpropanoyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]-2,2-dimethylpropan-1-one (PubChem CID 59289389) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-[(3aR,6aR)-5-(2,2-dimethylpropanoyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(3aR,6aR)-5-(2,2-dimethylpropanoyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 59289389 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 1-[(3aR,6aR)-5-(2,2-dimethylpropanoyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC1(C)C[C@@H]2C(C(=O)C(C)(C)C)N(C(=O)C(C)(C)C)C[C@@H]2O1 |
| InChI | InChI=1S/C18H31NO3/c1-16(2,3)14(20)13-11-9-18(7,8)22-12(11)10-19(13)15(21)17(4,5)6/h11-13H,9-10H2,1-8H3/t11-,12-,13?/m0/s1 |
| InChIKey | VZJCALIMBMDJTQ-VYAYZGMFSA-N |
| XLogP | 3.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |