About 5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene
5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene (PubChem CID 59289743) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is 5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene.
Analyze 5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene?
The IUPAC name of 5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene (CID 59289743) is 5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene.
What is the SMILES notation for 5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene?
The canonical SMILES for 5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene is CC1(C)CC2CCCC2C1.
What is the InChIKey of 5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene?
The InChIKey is PIKWCXUIKZDGIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18/c1-10(2)6-8-4-3-5-9(8)7-10/h8-9H,3-7H2,1-2H3.
What are the key properties of 5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene?
5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene has a molecular weight of 138.25 g/mol, XLogP of 3.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalene is sourced from PubChem (CID 59289743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).