C13H12N2O — CID 59289986
2-[(1R,2S,3S)-3-hydroxy-2-methyl-2,3-dihydro-1H-inden-1-yl]-2-isocyanoacetonitrile (PubChem CID 59289986) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[(1R,2S,3S)-3-hydroxy-2-methyl-2,3-dihydro-1H-inden-1-yl]-2-isocyanoacetonitrile.
| Compound Name | 2-[(1R,2S,3S)-3-hydroxy-2-methyl-2,3-dihydro-1H-inden-1-yl]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 59289986 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-[(1R,2S,3S)-3-hydroxy-2-methyl-2,3-dihydro-1H-inden-1-yl]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)[C@H]1c2ccccc2[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C13H12N2O/c1-8-12(11(7-14)15-2)9-5-3-4-6-10(9)13(8)16/h3-6,8,11-13,16H,1H3/t8-,11?,12+,13-/m0/s1 |
| InChIKey | UJOKGFIOMYMSND-WZOJZANDSA-N |
| XLogP | 2.26 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|