About N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide
N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide (PubChem CID 59290390) has the molecular formula C22H33NO5
and a molecular weight of 391.51 g/mol. Its IUPAC name is N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide |
| PubChem CID | 59290390 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide |
| SMILES | COC(CN(C(=O)CCOCCc1cccc(C=O)c1)C1CCCCC1)OC |
| InChI | InChI=1S/C22H33NO5/c1-26-22(27-2)16-23(20-9-4-3-5-10-20)21(25)12-14-28-13-11-18-7-6-8-19(15-18)17-24/h6-8,15,17,20,22H,3-5,9-14,16H2,1-2H3 |
| InChIKey | KJXKNHQTWUOFBT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide?
The IUPAC name of N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide (CID 59290390) is N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide.
What is the SMILES notation for N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide?
The canonical SMILES for N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide is COC(CN(C(=O)CCOCCc1cccc(C=O)c1)C1CCCCC1)OC.
What is the InChIKey of N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide?
The InChIKey is KJXKNHQTWUOFBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33NO5/c1-26-22(27-2)16-23(20-9-4-3-5-10-20)21(25)12-14-28-13-11-18-7-6-8-19(15-18)17-24/h6-8,15,17,20,22H,3-5,9-14,16H2,1-2H3.
What are the key properties of N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide?
N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide has a molecular weight of 391.51 g/mol, XLogP of 3.23, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-(3-formylphenyl)ethoxy]propanamide is sourced from PubChem (CID 59290390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).