C34H45N5O5 — CID 59290399
N-cyclohexyl-3-[2-[3-(1-ethylimidazol-2-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide (PubChem CID 59290399) has the molecular formula C34H45N5O5 and a molecular weight of 603.76 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-[3-(1-ethylimidazol-2-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide.
| Compound Name | N-cyclohexyl-3-[2-[3-(1-ethylimidazol-2-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 59290399 |
| Molecular Formula | C34H45N5O5 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | N-cyclohexyl-3-[2-[3-(1-ethylimidazol-2-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide |
| SMILES | CCn1ccnc1-c1cccc(CCOCCC(=O)N(CCNCCc2ccc(O)c3c2OCC(=O)N3)C2CCCCC2)c1 |
| InChI | InChI=1S/C34H45N5O5/c1-2-38-19-18-36-34(38)27-8-6-7-25(23-27)14-21-43-22-15-31(42)39(28-9-4-3-5-10-28)20-17-35-16-13-26-11-12-29(40)32-33(26)44-24-30(41)37-32/h6-8,11-12,18-19,23,28,35,40H,2-5,9-10,13-17,20-22,24H2,1H3,(H,37,41) |
| InChIKey | SPIYYWJNAYLABE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|