C33H42FN5O5 — CID 59290407
N-cyclohexyl-3-[2-[2-fluoro-3-(1-methylpyrazol-4-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide (PubChem CID 59290407) has the molecular formula C33H42FN5O5 and a molecular weight of 607.73 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-[2-fluoro-3-(1-methylpyrazol-4-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide.
| Compound Name | N-cyclohexyl-3-[2-[2-fluoro-3-(1-methylpyrazol-4-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 59290407 |
| Molecular Formula | C33H42FN5O5 |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | N-cyclohexyl-3-[2-[2-fluoro-3-(1-methylpyrazol-4-yl)phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide |
| SMILES | Cn1cc(-c2cccc(CCOCCC(=O)N(CCNCCc3ccc(O)c4c3OCC(=O)N4)C3CCCCC3)c2F)cn1 |
| InChI | InChI=1S/C33H42FN5O5/c1-38-21-25(20-36-38)27-9-5-6-23(31(27)34)13-18-43-19-14-30(42)39(26-7-3-2-4-8-26)17-16-35-15-12-24-10-11-28(40)32-33(24)44-22-29(41)37-32/h5-6,9-11,20-21,26,35,40H,2-4,7-8,12-19,22H2,1H3,(H,37,41) |
| InChIKey | HVIRSNRHQJSWBU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|