C27H44BNO6 — CID 59290414
N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethoxy]propanamide (PubChem CID 59290414) has the molecular formula C27H44BNO6 and a molecular weight of 489.46 g/mol. Its IUPAC name is N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethoxy]propanamide.
| Compound Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 59290414 |
| Molecular Formula | C27H44BNO6 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethoxy]propanamide |
| SMILES | COC(CN(C(=O)CCOCCc1cccc(B2OC(C)(C)C(C)(C)O2)c1)C1CCCCC1)OC |
| InChI | InChI=1S/C27H44BNO6/c1-26(2)27(3,4)35-28(34-26)22-12-10-11-21(19-22)15-17-33-18-16-24(30)29(20-25(31-5)32-6)23-13-8-7-9-14-23/h10-12,19,23,25H,7-9,13-18,20H2,1-6H3 |
| InChIKey | JIOGCJIJTMDLEB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|