C31H41N7O5 — CID 59290429
N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1-methyltetrazol-5-yl)phenyl]ethoxy]propanamide (PubChem CID 59290429) has the molecular formula C31H41N7O5 and a molecular weight of 591.71 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1-methyltetrazol-5-yl)phenyl]ethoxy]propanamide.
| Compound Name | N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1-methyltetrazol-5-yl)phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 59290429 |
| Molecular Formula | C31H41N7O5 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.32 |
| IUPAC Name | N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1-methyltetrazol-5-yl)phenyl]ethoxy]propanamide |
| SMILES | Cn1nnnc1-c1cccc(CCOCCC(=O)N(CCNCCc2ccc(O)c3c2OCC(=O)N3)C2CCCCC2)c1 |
| InChI | InChI=1S/C31H41N7O5/c1-37-31(34-35-36-37)24-7-5-6-22(20-24)13-18-42-19-14-28(41)38(25-8-3-2-4-9-25)17-16-32-15-12-23-10-11-26(39)29-30(23)43-21-27(40)33-29/h5-7,10-11,20,25,32,39H,2-4,8-9,12-19,21H2,1H3,(H,33,40) |
| InChIKey | BPLHVQQXDAEXIG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 143.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|