About 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate
1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate (PubChem CID 59291257) has the molecular formula C19H23N3O2S
and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate.
Molecular Properties
| Compound Name | 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate |
| PubChem CID | 59291257 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate |
| SMILES | O=C(Nc1ncsc1-c1ccccc1)OCC12CCCN(CC1)CC2 |
| InChI | InChI=1S/C19H23N3O2S/c23-18(24-13-19-7-4-10-22(11-8-19)12-9-19)21-17-16(25-14-20-17)15-5-2-1-3-6-15/h1-3,5-6,14H,4,7-13H2,(H,21,23) |
| InChIKey | HGACFFYPWSEVSW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate?
The IUPAC name of 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate (CID 59291257) is 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate.
What is the SMILES notation for 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate?
The canonical SMILES for 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate is O=C(Nc1ncsc1-c1ccccc1)OCC12CCCN(CC1)CC2.
What is the InChIKey of 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate?
The InChIKey is HGACFFYPWSEVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2S/c23-18(24-13-19-7-4-10-22(11-8-19)12-9-19)21-17-16(25-14-20-17)15-5-2-1-3-6-15/h1-3,5-6,14H,4,7-13H2,(H,21,23).
What are the key properties of 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate?
1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate has a molecular weight of 357.48 g/mol, XLogP of 4.23, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[3.2.2]nonan-5-ylmethyl N-(5-phenyl-1,3-thiazol-4-yl)carbamate is sourced from PubChem (CID 59291257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).