About 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate
1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate (PubChem CID 59291514) has the molecular formula C16H18ClN3O2S2
and a molecular weight of 383.93 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate |
| PubChem CID | 59291514 |
| Molecular Formula | C16H18ClN3O2S2 |
| Molecular Weight | 383.93 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate |
| SMILES | O=C(Nc1ncsc1-c1ccc(Cl)s1)OCC1CN2CCC1CC2 |
| InChI | InChI=1S/C16H18ClN3O2S2/c17-13-2-1-12(24-13)14-15(18-9-23-14)19-16(21)22-8-11-7-20-5-3-10(11)4-6-20/h1-2,9-11H,3-8H2,(H,19,21) |
| InChIKey | FIVLGMVDELUBHC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.93 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate?
The IUPAC name of 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate (CID 59291514) is 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate.
What is the SMILES notation for 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate?
The canonical SMILES for 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate is O=C(Nc1ncsc1-c1ccc(Cl)s1)OCC1CN2CCC1CC2.
What is the InChIKey of 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate?
The InChIKey is FIVLGMVDELUBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN3O2S2/c17-13-2-1-12(24-13)14-15(18-9-23-14)19-16(21)22-8-11-7-20-5-3-10(11)4-6-20/h1-2,9-11H,3-8H2,(H,19,21).
What are the key properties of 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate?
1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate has a molecular weight of 383.93 g/mol, XLogP of 4.42, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octan-3-ylmethyl N-[5-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]carbamate is sourced from PubChem (CID 59291514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).