About ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate
ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate (PubChem CID 59291517) has the molecular formula C10H9N3O2S
and a molecular weight of 235.27 g/mol. Its IUPAC name is ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate |
| PubChem CID | 59291517 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1-c1cnccn1 |
| InChI | InChI=1S/C10H9N3O2S/c1-2-15-10(14)8-9(16-6-13-8)7-5-11-3-4-12-7/h3-6H,2H2,1H3 |
| InChIKey | YQKLMHUHUVGYCP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate (CID 59291517) is ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate is CCOC(=O)c1ncsc1-c1cnccn1.
What is the InChIKey of ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate?
The InChIKey is YQKLMHUHUVGYCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2S/c1-2-15-10(14)8-9(16-6-13-8)7-5-11-3-4-12-7/h3-6H,2H2,1H3.
What are the key properties of ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate?
ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate has a molecular weight of 235.27 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-pyrazin-2-yl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 59291517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).