About 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate
1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate (PubChem CID 59291575) has the molecular formula C16H17N3O2S
and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate |
| PubChem CID | 59291575 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate |
| SMILES | O=C(Nc1ncsc1-c1ccccc1)OC12CCN(CC1)C2 |
| InChI | InChI=1S/C16H17N3O2S/c20-15(21-16-6-8-19(10-16)9-7-16)18-14-13(22-11-17-14)12-4-2-1-3-5-12/h1-5,11H,6-10H2,(H,18,20) |
| InChIKey | YVIQQWOEWNANFA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate?
The IUPAC name of 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate (CID 59291575) is 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate.
What is the SMILES notation for 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate?
The canonical SMILES for 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate is O=C(Nc1ncsc1-c1ccccc1)OC12CCN(CC1)C2.
What is the InChIKey of 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate?
The InChIKey is YVIQQWOEWNANFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2S/c20-15(21-16-6-8-19(10-16)9-7-16)18-14-13(22-11-17-14)12-4-2-1-3-5-12/h1-5,11H,6-10H2,(H,18,20).
What are the key properties of 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate?
1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate has a molecular weight of 315.40 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.1]heptan-4-yl N-(5-phenyl-1,3-thiazol-4-yl)carbamate is sourced from PubChem (CID 59291575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).