About 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine
4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine (PubChem CID 59291776) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine.
Molecular Properties
| Compound Name | 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine |
| PubChem CID | 59291776 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine |
| SMILES | CC(C)C1CCOc2cnccc21 |
| InChI | InChI=1S/C11H15NO/c1-8(2)9-4-6-13-11-7-12-5-3-10(9)11/h3,5,7-9H,4,6H2,1-2H3 |
| InChIKey | QYAWUWFTGSFOKY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine?
The IUPAC name of 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine (CID 59291776) is 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine.
What is the SMILES notation for 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine?
The canonical SMILES for 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine is CC(C)C1CCOc2cnccc21.
What is the InChIKey of 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine?
The InChIKey is QYAWUWFTGSFOKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-8(2)9-4-6-13-11-7-12-5-3-10(9)11/h3,5,7-9H,4,6H2,1-2H3.
What are the key properties of 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine?
4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine has a molecular weight of 177.25 g/mol, XLogP of 2.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-3,4-dihydro-2H-pyrano[2,3-c]pyridine is sourced from PubChem (CID 59291776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).