C22H26N8O4 — CID 59291889
N'-[3-[(3R,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-5-yl]-N-(2-methoxyethyl)oxamide (PubChem CID 59291889) has the molecular formula C22H26N8O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is N'-[3-[(3R,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-5-yl]-N-(2-methoxyethyl)oxamide.
| Compound Name | N'-[3-[(3R,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-5-yl]-N-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 59291889 |
| Molecular Formula | C22H26N8O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N'-[3-[(3R,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-5-yl]-N-(2-methoxyethyl)oxamide |
| SMILES | COCCNC(=O)C(=O)Nc1[nH]n([C@H]2CN(C(=O)CC#N)CC[C@H]2C)c2c1cnc1nccc12 |
| InChI | InChI=1S/C22H26N8O4/c1-13-5-9-29(17(31)3-6-23)12-16(13)30-18-14-4-7-24-19(14)26-11-15(18)20(28-30)27-22(33)21(32)25-8-10-34-2/h4,7,11,13,16,28H,3,5,8-10,12H2,1-2H3,(H,25,32)(H,27,33)/t13-,16+/m1/s1 |
| InChIKey | INUBQIOAFQKKMX-CJNGLKHVSA-N |
| XLogP | 0.94 |
| TPSA | 158.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|