About (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate
(4-nitrophenyl) N,N-bis(cyanomethyl)carbamate (PubChem CID 59291922) has the molecular formula C11H8N4O4
and a molecular weight of 260.21 g/mol. Its IUPAC name is (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate.
Molecular Properties
| Compound Name | (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate |
| PubChem CID | 59291922 |
| Molecular Formula | C11H8N4O4 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate |
| SMILES | N#CCN(CC#N)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H8N4O4/c12-5-7-14(8-6-13)11(16)19-10-3-1-9(2-4-10)15(17)18/h1-4H,7-8H2 |
| InChIKey | CETQBIYSIMDPAF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 120.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate?
The IUPAC name of (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate (CID 59291922) is (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate.
What is the SMILES notation for (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate?
The canonical SMILES for (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate is N#CCN(CC#N)C(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate?
The InChIKey is CETQBIYSIMDPAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O4/c12-5-7-14(8-6-13)11(16)19-10-3-1-9(2-4-10)15(17)18/h1-4H,7-8H2.
What are the key properties of (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate?
(4-nitrophenyl) N,N-bis(cyanomethyl)carbamate has a molecular weight of 260.21 g/mol, XLogP of 1.44, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) N,N-bis(cyanomethyl)carbamate is sourced from PubChem (CID 59291922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).