C35H40N4O5 — CID 59292573
1-[(2R)-2-hydroxycyclohexyl]-3-[[3-(2-phenoxyethoxy)phenyl]methyl]-5-phenyl-4-(piperazine-1-carbonyl)imidazol-2-one (PubChem CID 59292573) has the molecular formula C35H40N4O5 and a molecular weight of 596.73 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxycyclohexyl]-3-[[3-(2-phenoxyethoxy)phenyl]methyl]-5-phenyl-4-(piperazine-1-carbonyl)imidazol-2-one.
| Compound Name | 1-[(2R)-2-hydroxycyclohexyl]-3-[[3-(2-phenoxyethoxy)phenyl]methyl]-5-phenyl-4-(piperazine-1-carbonyl)imidazol-2-one |
|---|---|
| PubChem CID | 59292573 |
| Molecular Formula | C35H40N4O5 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 1-[(2R)-2-hydroxycyclohexyl]-3-[[3-(2-phenoxyethoxy)phenyl]methyl]-5-phenyl-4-(piperazine-1-carbonyl)imidazol-2-one |
| SMILES | O=C(c1c(-c2ccccc2)n(C2CCCC[C@H]2O)c(=O)n1Cc1cccc(OCCOc2ccccc2)c1)N1CCNCC1 |
| InChI | InChI=1S/C35H40N4O5/c40-31-17-8-7-16-30(31)39-32(27-11-3-1-4-12-27)33(34(41)37-20-18-36-19-21-37)38(35(39)42)25-26-10-9-15-29(24-26)44-23-22-43-28-13-5-2-6-14-28/h1-6,9-15,24,30-31,36,40H,7-8,16-23,25H2/t30?,31-/m1/s1 |
| InChIKey | JPTQYGIZKFRDMW-NLIBRCFJSA-N |
| XLogP | 4.34 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|