C24H24FN7O8 — CID 59293060
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[2-(tetrazol-2-yl)acetyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 59293060) has the molecular formula C24H24FN7O8 and a molecular weight of 557.50 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[2-(tetrazol-2-yl)acetyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[2-(tetrazol-2-yl)acetyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59293060 |
| Molecular Formula | C24H24FN7O8 |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[2-(tetrazol-2-yl)acetyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(NC(=O)Cn5ncnn5)cc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C24H24FN7O8/c1-31(2)17-10-4-8-3-9-11(25)5-12(29-13(33)6-32-28-7-27-30-32)18(34)15(9)19(35)14(8)21(37)24(10,40)22(38)16(20(17)36)23(26)39/h5,7-8,10,17,34-35,38,40H,3-4,6H2,1-2H3,(H2,26,39)(H,29,33)/t8-,10-,17-,24-/m0/s1 |
| InChIKey | FFTLKVHGIMXPRD-SUUIHLIUSA-N |
| XLogP | -1.27 |
| TPSA | 234.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|